Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3314 | Purity: >98% |
 | |
| Chemical structure of Dibenzofuran-3-ylamine hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 91493-29-7 |
|---|---|
| Purity | >98% |
| Formula | C12H10ClNO |
| Mol Weight | 219.667 |
| CoA | CoA of Dibenzofuran-3-ylamine hydrochloride |
| Smiles: | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)N.Cl |
|---|
KEYWORDS: buy Dibenzofuran-3-ylamine hydrochloride | Dibenzofuran-3-ylamine hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 91493-29-7 | 91493-29-7 supplier